About 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid
5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 64629679) has the molecular formula C12H7N3O4S
and a molecular weight of 289.27 g/mol. Its IUPAC name is 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 64629679 |
| Molecular Formula | C12H7N3O4S |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C1NC(=O)c2cc(Nc3scnc3C(=O)O)ccc21 |
| InChI | InChI=1S/C12H7N3O4S/c16-9-6-2-1-5(3-7(6)10(17)15-9)14-11-8(12(18)19)13-4-20-11/h1-4,14H,(H,18,19)(H,15,16,17) |
| InChIKey | CMIVCIXZEQMXRW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid (CID 64629679) is 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid is O=C1NC(=O)c2cc(Nc3scnc3C(=O)O)ccc21.
What is the InChIKey of 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid?
The InChIKey is CMIVCIXZEQMXRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O4S/c16-9-6-2-1-5(3-7(6)10(17)15-9)14-11-8(12(18)19)13-4-20-11/h1-4,14H,(H,18,19)(H,15,16,17).
What are the key properties of 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid?
5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid has a molecular weight of 289.27 g/mol, XLogP of 1.47, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1,3-dioxoisoindol-5-yl)amino]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 64629679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).