About 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide
3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide (PubChem CID 64630190) has the molecular formula C9H18ClNO3S
and a molecular weight of 255.77 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide |
| PubChem CID | 64630190 |
| Molecular Formula | C9H18ClNO3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide |
| SMILES | CC(CS(C)(=O)=O)NC(=O)C(C)(C)CCl |
| InChI | InChI=1S/C9H18ClNO3S/c1-7(5-15(4,13)14)11-8(12)9(2,3)6-10/h7H,5-6H2,1-4H3,(H,11,12) |
| InChIKey | WXYUEQHKSJQPNC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide?
The IUPAC name of 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide (CID 64630190) is 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide.
What is the SMILES notation for 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide?
The canonical SMILES for 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide is CC(CS(C)(=O)=O)NC(=O)C(C)(C)CCl.
What is the InChIKey of 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide?
The InChIKey is WXYUEQHKSJQPNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18ClNO3S/c1-7(5-15(4,13)14)11-8(12)9(2,3)6-10/h7H,5-6H2,1-4H3,(H,11,12).
What are the key properties of 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide?
3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide has a molecular weight of 255.77 g/mol, XLogP of 0.80, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,2-dimethyl-N-(1-methylsulfonylpropan-2-yl)propanamide is sourced from PubChem (CID 64630190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).