About 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid
5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 64631291) has the molecular formula C7H10N2O3S
and a molecular weight of 202.23 g/mol. Its IUPAC name is 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 64631291 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | COCCNc1scnc1C(=O)O |
| InChI | InChI=1S/C7H10N2O3S/c1-12-3-2-8-6-5(7(10)11)9-4-13-6/h4,8H,2-3H2,1H3,(H,10,11) |
| InChIKey | YBRHTFJSBDFQKY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid (CID 64631291) is 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid is COCCNc1scnc1C(=O)O.
What is the InChIKey of 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid?
The InChIKey is YBRHTFJSBDFQKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3S/c1-12-3-2-8-6-5(7(10)11)9-4-13-6/h4,8H,2-3H2,1H3,(H,10,11).
What are the key properties of 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid?
5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid has a molecular weight of 202.23 g/mol, XLogP of 0.90, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methoxyethylamino)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 64631291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).