C17H25N5O3 — CID 6463130
2-(2-ethoxyethyl)-4,7,8-trimethyl-6-propan-2-ylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 6463130) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-4,7,8-trimethyl-6-propan-2-ylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2-(2-ethoxyethyl)-4,7,8-trimethyl-6-propan-2-ylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 6463130 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-(2-ethoxyethyl)-4,7,8-trimethyl-6-propan-2-ylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCOCCn1c(=O)c2c(nc3n(C(C)C)c(C)c(C)n23)n(C)c1=O |
| InChI | InChI=1S/C17H25N5O3/c1-7-25-9-8-20-15(23)13-14(19(6)17(20)24)18-16-21(10(2)3)11(4)12(5)22(13)16/h10H,7-9H2,1-6H3 |
| InChIKey | DRELGUWNSYXWGQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|