C16H19BrN2OS — CID 64631451
1-[3-[(3-bromo-2-pyridinyl)sulfanylmethyl]-4-methoxyphenyl]-N-methylethanamine (PubChem CID 64631451) has the molecular formula C16H19BrN2OS and a molecular weight of 367.31 g/mol. Its IUPAC name is 1-[3-[(3-bromo-2-pyridinyl)sulfanylmethyl]-4-methoxyphenyl]-N-methylethanamine.
| Compound Name | 1-[3-[(3-bromo-2-pyridinyl)sulfanylmethyl]-4-methoxyphenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 64631451 |
| Molecular Formula | C16H19BrN2OS |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 1-[3-[(3-bromo-2-pyridinyl)sulfanylmethyl]-4-methoxyphenyl]-N-methylethanamine |
| SMILES | CNC(C)c1ccc(OC)c(CSc2ncccc2Br)c1 |
| InChI | InChI=1S/C16H19BrN2OS/c1-11(18-2)12-6-7-15(20-3)13(9-12)10-21-16-14(17)5-4-8-19-16/h4-9,11,18H,10H2,1-3H3 |
| InChIKey | GTABGWZNYOPILE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |