C9H21NO4S — CID 64631589
1,1-dimethoxy-N-(1-methylsulfonylpropan-2-yl)propan-2-amine (PubChem CID 64631589) has the molecular formula C9H21NO4S and a molecular weight of 239.34 g/mol. Its IUPAC name is 1,1-dimethoxy-N-(1-methylsulfonylpropan-2-yl)propan-2-amine.
| Compound Name | 1,1-dimethoxy-N-(1-methylsulfonylpropan-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 64631589 |
| Molecular Formula | C9H21NO4S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1,1-dimethoxy-N-(1-methylsulfonylpropan-2-yl)propan-2-amine |
| SMILES | COC(OC)C(C)NC(C)CS(C)(=O)=O |
| InChI | InChI=1S/C9H21NO4S/c1-7(6-15(5,11)12)10-8(2)9(13-3)14-4/h7-10H,6H2,1-5H3 |
| InChIKey | GKAZEEQJUSZLIF-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|