C17H19N3O2 — CID 6463277
5-butyl-6-methyl-2-phenyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione (PubChem CID 6463277) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 5-butyl-6-methyl-2-phenyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione.
| Compound Name | 5-butyl-6-methyl-2-phenyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
|---|---|
| PubChem CID | 6463277 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 5-butyl-6-methyl-2-phenyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
| SMILES | CCCCc1c(C)[nH]c2[nH]n(-c3ccccc3)c(=O)c2c1=O |
| InChI | InChI=1S/C17H19N3O2/c1-3-4-10-13-11(2)18-16-14(15(13)21)17(22)20(19-16)12-8-6-5-7-9-12/h5-9H,3-4,10H2,1-2H3,(H2,18,19,21) |
| InChIKey | SWEHFOSAYDUXIU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|