About 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one
2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 6463281) has the molecular formula C18H13N3O
and a molecular weight of 287.32 g/mol. Its IUPAC name is 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one.
Molecular Properties
| Compound Name | 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one |
| PubChem CID | 6463281 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | O=c1c2c(-c3ccccc3)ccnc2[nH]n1-c1ccccc1 |
| InChI | InChI=1S/C18H13N3O/c22-18-16-15(13-7-3-1-4-8-13)11-12-19-17(16)20-21(18)14-9-5-2-6-10-14/h1-12H,(H,19,20) |
| InChIKey | ARSMGRZKAYPZMA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one?
The IUPAC name of 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one (CID 6463281) is 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one.
What is the SMILES notation for 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one?
The canonical SMILES for 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one is O=c1c2c(-c3ccccc3)ccnc2[nH]n1-c1ccccc1.
What is the InChIKey of 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one?
The InChIKey is ARSMGRZKAYPZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O/c22-18-16-15(13-7-3-1-4-8-13)11-12-19-17(16)20-21(18)14-9-5-2-6-10-14/h1-12H,(H,19,20).
What are the key properties of 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one?
2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one has a molecular weight of 287.32 g/mol, XLogP of 3.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one is sourced from PubChem (CID 6463281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).