About 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine
2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine (PubChem CID 64633090) has the molecular formula C11H19N3OS
and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine.
Molecular Properties
| Compound Name | 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine |
| PubChem CID | 64633090 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine |
| SMILES | Cc1nnc(SC2CCCCCCC2N)o1 |
| InChI | InChI=1S/C11H19N3OS/c1-8-13-14-11(15-8)16-10-7-5-3-2-4-6-9(10)12/h9-10H,2-7,12H2,1H3 |
| InChIKey | RHJMUJYZXKFNQQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine?
The IUPAC name of 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine (CID 64633090) is 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine.
What is the SMILES notation for 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine?
The canonical SMILES for 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine is Cc1nnc(SC2CCCCCCC2N)o1.
What is the InChIKey of 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine?
The InChIKey is RHJMUJYZXKFNQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3OS/c1-8-13-14-11(15-8)16-10-7-5-3-2-4-6-9(10)12/h9-10H,2-7,12H2,1H3.
What are the key properties of 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine?
2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine has a molecular weight of 241.36 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclooctan-1-amine is sourced from PubChem (CID 64633090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).