About 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine
3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine (PubChem CID 64633095) has the molecular formula C10H19N3OS
and a molecular weight of 229.35 g/mol. Its IUPAC name is 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine.
Molecular Properties
| Compound Name | 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine |
| PubChem CID | 64633095 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine |
| SMILES | CCCC(N)C(CC)Sc1nnc(C)o1 |
| InChI | InChI=1S/C10H19N3OS/c1-4-6-8(11)9(5-2)15-10-13-12-7(3)14-10/h8-9H,4-6,11H2,1-3H3 |
| InChIKey | KDZYHOBKYSTRBD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine?
The IUPAC name of 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine (CID 64633095) is 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine.
What is the SMILES notation for 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine?
The canonical SMILES for 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine is CCCC(N)C(CC)Sc1nnc(C)o1.
What is the InChIKey of 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine?
The InChIKey is KDZYHOBKYSTRBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3OS/c1-4-6-8(11)9(5-2)15-10-13-12-7(3)14-10/h8-9H,4-6,11H2,1-3H3.
What are the key properties of 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine?
3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine has a molecular weight of 229.35 g/mol, XLogP of 2.38, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]heptan-4-amine is sourced from PubChem (CID 64633095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).