About 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine
6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine (PubChem CID 64633700) has the molecular formula C12H21N3S
and a molecular weight of 239.39 g/mol. Its IUPAC name is 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine.
Molecular Properties
| Compound Name | 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine |
| PubChem CID | 64633700 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine |
| SMILES | Cc1cc(C)nc(SCCCCC(C)N)n1 |
| InChI | InChI=1S/C12H21N3S/c1-9(13)6-4-5-7-16-12-14-10(2)8-11(3)15-12/h8-9H,4-7,13H2,1-3H3 |
| InChIKey | VLKNXJNLOXDGLB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine?
The IUPAC name of 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine (CID 64633700) is 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine.
What is the SMILES notation for 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine?
The canonical SMILES for 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine is Cc1cc(C)nc(SCCCCC(C)N)n1.
What is the InChIKey of 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine?
The InChIKey is VLKNXJNLOXDGLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3S/c1-9(13)6-4-5-7-16-12-14-10(2)8-11(3)15-12/h8-9H,4-7,13H2,1-3H3.
What are the key properties of 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine?
6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine has a molecular weight of 239.39 g/mol, XLogP of 2.70, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,6-dimethylpyrimidin-2-yl)sulfanylhexan-2-amine is sourced from PubChem (CID 64633700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).