C14H23NS — CID 64634189
N-methyl-2-[(3-methylphenyl)methylsulfanyl]pentan-3-amine (PubChem CID 64634189) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is N-methyl-2-[(3-methylphenyl)methylsulfanyl]pentan-3-amine.
| Compound Name | N-methyl-2-[(3-methylphenyl)methylsulfanyl]pentan-3-amine |
|---|---|
| PubChem CID | 64634189 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | N-methyl-2-[(3-methylphenyl)methylsulfanyl]pentan-3-amine |
| SMILES | CCC(NC)C(C)SCc1cccc(C)c1 |
| InChI | InChI=1S/C14H23NS/c1-5-14(15-4)12(3)16-10-13-8-6-7-11(2)9-13/h6-9,12,14-15H,5,10H2,1-4H3 |
| InChIKey | HDPUUNVJEMZVIK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |