About 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine
2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine (PubChem CID 64634815) has the molecular formula C15H29NS
and a molecular weight of 255.47 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine |
| PubChem CID | 64634815 |
| Molecular Formula | C15H29NS |
| Molecular Weight | 255.47 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine |
| SMILES | CNC1CCC(C)(C)CC1SC1CCCCC1 |
| InChI | InChI=1S/C15H29NS/c1-15(2)10-9-13(16-3)14(11-15)17-12-7-5-4-6-8-12/h12-14,16H,4-11H2,1-3H3 |
| InChIKey | VMQCMJMCRMCQIY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine?
The IUPAC name of 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine (CID 64634815) is 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine.
What is the SMILES notation for 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine?
The canonical SMILES for 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine is CNC1CCC(C)(C)CC1SC1CCCCC1.
What is the InChIKey of 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine?
The InChIKey is VMQCMJMCRMCQIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NS/c1-15(2)10-9-13(16-3)14(11-15)17-12-7-5-4-6-8-12/h12-14,16H,4-11H2,1-3H3.
What are the key properties of 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine?
2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine has a molecular weight of 255.47 g/mol, XLogP of 4.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylsulfanyl-N,4,4-trimethylcyclohexan-1-amine is sourced from PubChem (CID 64634815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).