About 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine
3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine (PubChem CID 64634872) has the molecular formula C8H13N3O2S
and a molecular weight of 215.28 g/mol. Its IUPAC name is 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine.
Molecular Properties
| Compound Name | 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine |
| PubChem CID | 64634872 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine |
| SMILES | Cc1nnc(SC2COCCC2N)o1 |
| InChI | InChI=1S/C8H13N3O2S/c1-5-10-11-8(13-5)14-7-4-12-3-2-6(7)9/h6-7H,2-4,9H2,1H3 |
| InChIKey | FXJHOENUSUJPPW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine?
The IUPAC name of 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine (CID 64634872) is 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine.
What is the SMILES notation for 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine?
The canonical SMILES for 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine is Cc1nnc(SC2COCCC2N)o1.
What is the InChIKey of 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine?
The InChIKey is FXJHOENUSUJPPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2S/c1-5-10-11-8(13-5)14-7-4-12-3-2-6(7)9/h6-7H,2-4,9H2,1H3.
What are the key properties of 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine?
3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine has a molecular weight of 215.28 g/mol, XLogP of 0.59, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]oxan-4-amine is sourced from PubChem (CID 64634872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).