C13H18O5S2 — CID 64635480
1-(2-methoxy-4-methylphenyl)-2-(2-methylsulfonylethylsulfinyl)ethanone (PubChem CID 64635480) has the molecular formula C13H18O5S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(2-methoxy-4-methylphenyl)-2-(2-methylsulfonylethylsulfinyl)ethanone.
| Compound Name | 1-(2-methoxy-4-methylphenyl)-2-(2-methylsulfonylethylsulfinyl)ethanone |
|---|---|
| PubChem CID | 64635480 |
| Molecular Formula | C13H18O5S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-(2-methoxy-4-methylphenyl)-2-(2-methylsulfonylethylsulfinyl)ethanone |
| SMILES | COc1cc(C)ccc1C(=O)CS(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C13H18O5S2/c1-10-4-5-11(13(8-10)18-2)12(14)9-19(15)6-7-20(3,16)17/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | YZPNQGJWHYXGMC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |