C15H22O4S — CID 64636016
1-(2,5-dimethylphenyl)-2-(3-methoxypropylsulfonyl)propan-1-one (PubChem CID 64636016) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-(3-methoxypropylsulfonyl)propan-1-one.
| Compound Name | 1-(2,5-dimethylphenyl)-2-(3-methoxypropylsulfonyl)propan-1-one |
|---|---|
| PubChem CID | 64636016 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-(3-methoxypropylsulfonyl)propan-1-one |
| SMILES | COCCCS(=O)(=O)C(C)C(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C15H22O4S/c1-11-6-7-12(2)14(10-11)15(16)13(3)20(17,18)9-5-8-19-4/h6-7,10,13H,5,8-9H2,1-4H3 |
| InChIKey | WCRIHHJTZIMCBF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|