About 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline
2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline (PubChem CID 6463631) has the molecular formula C14H10BrN3O
and a molecular weight of 316.16 g/mol. Its IUPAC name is 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline.
Molecular Properties
| Compound Name | 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline |
| PubChem CID | 6463631 |
| Molecular Formula | C14H10BrN3O |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline |
| SMILES | Nc1ccccc1-c1nnc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C14H10BrN3O/c15-10-7-5-9(6-8-10)13-17-18-14(19-13)11-3-1-2-4-12(11)16/h1-8H,16H2 |
| InChIKey | VYRNDKXEJYMINE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline?
The IUPAC name of 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline (CID 6463631) is 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline.
What is the SMILES notation for 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline?
The canonical SMILES for 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline is Nc1ccccc1-c1nnc(-c2ccc(Br)cc2)o1.
What is the InChIKey of 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline?
The InChIKey is VYRNDKXEJYMINE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrN3O/c15-10-7-5-9(6-8-10)13-17-18-14(19-13)11-3-1-2-4-12(11)16/h1-8H,16H2.
What are the key properties of 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline?
2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline has a molecular weight of 316.16 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]aniline is sourced from PubChem (CID 6463631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).