C14H9BrF2O3S — CID 64637514
2-(3-bromophenyl)sulfonyl-1-(2,5-difluorophenyl)ethanone (PubChem CID 64637514) has the molecular formula C14H9BrF2O3S and a molecular weight of 375.19 g/mol. Its IUPAC name is 2-(3-bromophenyl)sulfonyl-1-(2,5-difluorophenyl)ethanone.
| Compound Name | 2-(3-bromophenyl)sulfonyl-1-(2,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 64637514 |
| Molecular Formula | C14H9BrF2O3S |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 373.94 |
| IUPAC Name | 2-(3-bromophenyl)sulfonyl-1-(2,5-difluorophenyl)ethanone |
| SMILES | O=C(CS(=O)(=O)c1cccc(Br)c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H9BrF2O3S/c15-9-2-1-3-11(6-9)21(19,20)8-14(18)12-7-10(16)4-5-13(12)17/h1-7H,8H2 |
| InChIKey | RFGWYWLWYJGORY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |