C13H18O4S — CID 64637916
2-(3-methoxypropylsulfonyl)-1-(3-methylphenyl)ethanone (PubChem CID 64637916) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-(3-methoxypropylsulfonyl)-1-(3-methylphenyl)ethanone.
| Compound Name | 2-(3-methoxypropylsulfonyl)-1-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 64637916 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-(3-methoxypropylsulfonyl)-1-(3-methylphenyl)ethanone |
| SMILES | COCCCS(=O)(=O)CC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C13H18O4S/c1-11-5-3-6-12(9-11)13(14)10-18(15,16)8-4-7-17-2/h3,5-6,9H,4,7-8,10H2,1-2H3 |
| InChIKey | YGQWICULSZPCLT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|