C22H23N3O2S — CID 646394
3-(furan-2-ylmethyl)-7-methyl-N-(oxolan-2-ylmethyl)-4H-[1,3]thiazino[6,5-b]quinolin-2-imine (PubChem CID 646394) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-7-methyl-N-(oxolan-2-ylmethyl)-4H-[1,3]thiazino[6,5-b]quinolin-2-imine.
| Compound Name | 3-(furan-2-ylmethyl)-7-methyl-N-(oxolan-2-ylmethyl)-4H-[1,3]thiazino[6,5-b]quinolin-2-imine |
|---|---|
| PubChem CID | 646394 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-(furan-2-ylmethyl)-7-methyl-N-(oxolan-2-ylmethyl)-4H-[1,3]thiazino[6,5-b]quinolin-2-imine |
| SMILES | Cc1ccc2nc3c(cc2c1)CN(Cc1ccco1)/C(=N/CC1CCCO1)S3 |
| InChI | InChI=1S/C22H23N3O2S/c1-15-6-7-20-16(10-15)11-17-13-25(14-19-5-3-9-27-19)22(28-21(17)24-20)23-12-18-4-2-8-26-18/h3,5-7,9-11,18H,2,4,8,12-14H2,1H3/b23-22- |
| InChIKey | ROBCXNPTPOORGP-FCQUAONHSA-N |
| XLogP | 4.78 |
| TPSA | 50.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|