C14H20O2S — CID 64640081
1-(2,5-dimethylphenyl)-2-propylsulfinylpropan-1-one (PubChem CID 64640081) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-propylsulfinylpropan-1-one.
| Compound Name | 1-(2,5-dimethylphenyl)-2-propylsulfinylpropan-1-one |
|---|---|
| PubChem CID | 64640081 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-propylsulfinylpropan-1-one |
| SMILES | CCCS(=O)C(C)C(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C14H20O2S/c1-5-8-17(16)12(4)14(15)13-9-10(2)6-7-11(13)3/h6-7,9,12H,5,8H2,1-4H3 |
| InChIKey | HNOURVKVKYLLSU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |