C16H26O3S — CID 64641264
1-(3,3-diethoxypropylsulfinyl)-4-propan-2-ylbenzene (PubChem CID 64641264) has the molecular formula C16H26O3S and a molecular weight of 298.45 g/mol. Its IUPAC name is 1-(3,3-diethoxypropylsulfinyl)-4-propan-2-ylbenzene.
| Compound Name | 1-(3,3-diethoxypropylsulfinyl)-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 64641264 |
| Molecular Formula | C16H26O3S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 1-(3,3-diethoxypropylsulfinyl)-4-propan-2-ylbenzene |
| SMILES | CCOC(CCS(=O)c1ccc(C(C)C)cc1)OCC |
| InChI | InChI=1S/C16H26O3S/c1-5-18-16(19-6-2)11-12-20(17)15-9-7-14(8-10-15)13(3)4/h7-10,13,16H,5-6,11-12H2,1-4H3 |
| InChIKey | YBSMWKVDXCBVGK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|