About 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one
5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 64641697) has the molecular formula C12H16N2O3S3
and a molecular weight of 332.47 g/mol. Its IUPAC name is 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 64641697 |
| Molecular Formula | C12H16N2O3S3 |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2[nH]c(=S)n(C(C)CS(C)(=O)=O)c(=O)c2c1C |
| InChI | InChI=1S/C12H16N2O3S3/c1-6(5-20(4,16)17)14-11(15)9-7(2)8(3)19-10(9)13-12(14)18/h6H,5H2,1-4H3,(H,13,18) |
| InChIKey | UBGJZKNCXHXFPI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CID 64641697) is 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one is Cc1sc2[nH]c(=S)n(C(C)CS(C)(=O)=O)c(=O)c2c1C.
What is the InChIKey of 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one?
The InChIKey is UBGJZKNCXHXFPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3S3/c1-6(5-20(4,16)17)14-11(15)9-7(2)8(3)19-10(9)13-12(14)18/h6H,5H2,1-4H3,(H,13,18).
What are the key properties of 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one?
5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one has a molecular weight of 332.47 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-3-(1-methylsulfonylpropan-2-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 64641697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).