About ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate
ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate (PubChem CID 6464202) has the molecular formula C21H22N2O6
and a molecular weight of 398.42 g/mol. Its IUPAC name is ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate.
Molecular Properties
| Compound Name | ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate |
| PubChem CID | 6464202 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate |
| SMILES | CCOC(=O)c1ccc(N2CCOCC2)c(NC(=O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C21H22N2O6/c1-2-27-21(25)15-3-5-17(23-7-9-26-10-8-23)16(11-15)22-20(24)14-4-6-18-19(12-14)29-13-28-18/h3-6,11-12H,2,7-10,13H2,1H3,(H,22,24) |
| InChIKey | CNQQTTWKLCZOFI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate?
The IUPAC name of ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate (CID 6464202) is ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate.
What is the SMILES notation for ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate?
The canonical SMILES for ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate is CCOC(=O)c1ccc(N2CCOCC2)c(NC(=O)c2ccc3c(c2)OCO3)c1.
What is the InChIKey of ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate?
The InChIKey is CNQQTTWKLCZOFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O6/c1-2-27-21(25)15-3-5-17(23-7-9-26-10-8-23)16(11-15)22-20(24)14-4-6-18-19(12-14)29-13-28-18/h3-6,11-12H,2,7-10,13H2,1H3,(H,22,24).
What are the key properties of ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate?
ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate has a molecular weight of 398.42 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(1,3-benzodioxole-5-carbonylamino)-4-morpholin-4-ylbenzoate is sourced from PubChem (CID 6464202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).