C9H14N4O2S2 — CID 64643990
3-(1-methylsulfonylpropan-2-ylamino)pyrazine-2-carbothioamide (PubChem CID 64643990) has the molecular formula C9H14N4O2S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 3-(1-methylsulfonylpropan-2-ylamino)pyrazine-2-carbothioamide.
| Compound Name | 3-(1-methylsulfonylpropan-2-ylamino)pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 64643990 |
| Molecular Formula | C9H14N4O2S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3-(1-methylsulfonylpropan-2-ylamino)pyrazine-2-carbothioamide |
| SMILES | CC(CS(C)(=O)=O)Nc1nccnc1C(N)=S |
| InChI | InChI=1S/C9H14N4O2S2/c1-6(5-17(2,14)15)13-9-7(8(10)16)11-3-4-12-9/h3-4,6H,5H2,1-2H3,(H2,10,16)(H,12,13) |
| InChIKey | SNWRIKHWGCOLQB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|