C11H13F3N2O4S — CID 64644384
N-(1-methylsulfonylpropan-2-yl)-4-nitro-3-(trifluoromethyl)aniline (PubChem CID 64644384) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is N-(1-methylsulfonylpropan-2-yl)-4-nitro-3-(trifluoromethyl)aniline.
| Compound Name | N-(1-methylsulfonylpropan-2-yl)-4-nitro-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 64644384 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | N-(1-methylsulfonylpropan-2-yl)-4-nitro-3-(trifluoromethyl)aniline |
| SMILES | CC(CS(C)(=O)=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2O4S/c1-7(6-21(2,19)20)15-8-3-4-10(16(17)18)9(5-8)11(12,13)14/h3-5,7,15H,6H2,1-2H3 |
| InChIKey | PDERFQQPLKNTBL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|