C22H30N2O6 — CID 646444
N'-benzyl-N'-[(2,4-dimethoxyphenyl)methyl]-N,N-dimethylethane-1,2-diamine;oxalic acid (PubChem CID 646444) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is N'-benzyl-N'-[(2,4-dimethoxyphenyl)methyl]-N,N-dimethylethane-1,2-diamine;oxalic acid.
| Compound Name | N'-benzyl-N'-[(2,4-dimethoxyphenyl)methyl]-N,N-dimethylethane-1,2-diamine;oxalic acid |
|---|---|
| PubChem CID | 646444 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | N'-benzyl-N'-[(2,4-dimethoxyphenyl)methyl]-N,N-dimethylethane-1,2-diamine;oxalic acid |
| SMILES | COc1ccc(CN(CCN(C)C)Cc2ccccc2)c(OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H28N2O2.C2H2O4/c1-21(2)12-13-22(15-17-8-6-5-7-9-17)16-18-10-11-19(23-3)14-20(18)24-4;3-1(4)2(5)6/h5-11,14H,12-13,15-16H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | KJQXUPBGDUFOMF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|