About 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine
6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine (PubChem CID 64644414) has the molecular formula C10H16ClN3O2S
and a molecular weight of 277.78 g/mol. Its IUPAC name is 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine.
Molecular Properties
| Compound Name | 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine |
| PubChem CID | 64644414 |
| Molecular Formula | C10H16ClN3O2S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine |
| SMILES | Cc1c(Cl)nnc(NC(C)CS(C)(=O)=O)c1C |
| InChI | InChI=1S/C10H16ClN3O2S/c1-6(5-17(4,15)16)12-10-8(3)7(2)9(11)13-14-10/h6H,5H2,1-4H3,(H,12,14) |
| InChIKey | KHIDMTCHPOGAMH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine?
The IUPAC name of 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine (CID 64644414) is 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine.
What is the SMILES notation for 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine?
The canonical SMILES for 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine is Cc1c(Cl)nnc(NC(C)CS(C)(=O)=O)c1C.
What is the InChIKey of 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine?
The InChIKey is KHIDMTCHPOGAMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3O2S/c1-6(5-17(4,15)16)12-10-8(3)7(2)9(11)13-14-10/h6H,5H2,1-4H3,(H,12,14).
What are the key properties of 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine?
6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine has a molecular weight of 277.78 g/mol, XLogP of 1.59, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4,5-dimethyl-N-(1-methylsulfonylpropan-2-yl)pyridazin-3-amine is sourced from PubChem (CID 64644414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).