C13H18BrNO3S — CID 64644847
3-(2-bromophenyl)sulfonyl-N-ethyloxan-4-amine (PubChem CID 64644847) has the molecular formula C13H18BrNO3S and a molecular weight of 348.26 g/mol. Its IUPAC name is 3-(2-bromophenyl)sulfonyl-N-ethyloxan-4-amine.
| Compound Name | 3-(2-bromophenyl)sulfonyl-N-ethyloxan-4-amine |
|---|---|
| PubChem CID | 64644847 |
| Molecular Formula | C13H18BrNO3S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 3-(2-bromophenyl)sulfonyl-N-ethyloxan-4-amine |
| SMILES | CCNC1CCOCC1S(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C13H18BrNO3S/c1-2-15-11-7-8-18-9-13(11)19(16,17)12-6-4-3-5-10(12)14/h3-6,11,13,15H,2,7-9H2,1H3 |
| InChIKey | ZYJNHXLXWIRBMO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |