C12H17NO4S — CID 64644872
3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-methylpropan-1-amine (PubChem CID 64644872) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-methylpropan-1-amine.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 64644872 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-methylpropan-1-amine |
| SMILES | CNCCCS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H17NO4S/c1-13-5-2-8-18(14,15)10-3-4-11-12(9-10)17-7-6-16-11/h3-4,9,13H,2,5-8H2,1H3 |
| InChIKey | DDAYOWUXAJEVJX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|