C14H22N2O4S — CID 64646135
N-ethyl-3,3-dimethyl-1-(2-nitrophenyl)sulfonylbutan-2-amine (PubChem CID 64646135) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-ethyl-3,3-dimethyl-1-(2-nitrophenyl)sulfonylbutan-2-amine.
| Compound Name | N-ethyl-3,3-dimethyl-1-(2-nitrophenyl)sulfonylbutan-2-amine |
|---|---|
| PubChem CID | 64646135 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-ethyl-3,3-dimethyl-1-(2-nitrophenyl)sulfonylbutan-2-amine |
| SMILES | CCNC(CS(=O)(=O)c1ccccc1[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C14H22N2O4S/c1-5-15-13(14(2,3)4)10-21(19,20)12-9-7-6-8-11(12)16(17)18/h6-9,13,15H,5,10H2,1-4H3 |
| InChIKey | FRGFLVTVWZLUHK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|