About 1-ethylsulfonyl-3,3-dimethylbutan-2-amine
1-ethylsulfonyl-3,3-dimethylbutan-2-amine (PubChem CID 64646580) has the molecular formula C8H19NO2S
and a molecular weight of 193.31 g/mol. Its IUPAC name is 1-ethylsulfonyl-3,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 1-ethylsulfonyl-3,3-dimethylbutan-2-amine |
| PubChem CID | 64646580 |
| Molecular Formula | C8H19NO2S |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-ethylsulfonyl-3,3-dimethylbutan-2-amine |
| SMILES | CCS(=O)(=O)CC(N)C(C)(C)C |
| InChI | InChI=1S/C8H19NO2S/c1-5-12(10,11)6-7(9)8(2,3)4/h7H,5-6,9H2,1-4H3 |
| InChIKey | RGYHQTXWNSXDSS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethylsulfonyl-3,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfonyl-3,3-dimethylbutan-2-amine?
The IUPAC name of 1-ethylsulfonyl-3,3-dimethylbutan-2-amine (CID 64646580) is 1-ethylsulfonyl-3,3-dimethylbutan-2-amine.
What is the SMILES notation for 1-ethylsulfonyl-3,3-dimethylbutan-2-amine?
The canonical SMILES for 1-ethylsulfonyl-3,3-dimethylbutan-2-amine is CCS(=O)(=O)CC(N)C(C)(C)C.
What is the InChIKey of 1-ethylsulfonyl-3,3-dimethylbutan-2-amine?
The InChIKey is RGYHQTXWNSXDSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO2S/c1-5-12(10,11)6-7(9)8(2,3)4/h7H,5-6,9H2,1-4H3.
What are the key properties of 1-ethylsulfonyl-3,3-dimethylbutan-2-amine?
1-ethylsulfonyl-3,3-dimethylbutan-2-amine has a molecular weight of 193.31 g/mol, XLogP of 0.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfonyl-3,3-dimethylbutan-2-amine is sourced from PubChem (CID 64646580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).