C12H18BrNO2S — CID 64646640
1-(2-bromophenyl)sulfonyl-3,3-dimethylbutan-2-amine (PubChem CID 64646640) has the molecular formula C12H18BrNO2S and a molecular weight of 320.25 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfonyl-3,3-dimethylbutan-2-amine.
| Compound Name | 1-(2-bromophenyl)sulfonyl-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 64646640 |
| Molecular Formula | C12H18BrNO2S |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 1-(2-bromophenyl)sulfonyl-3,3-dimethylbutan-2-amine |
| SMILES | CC(C)(C)C(N)CS(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C12H18BrNO2S/c1-12(2,3)11(14)8-17(15,16)10-7-5-4-6-9(10)13/h4-7,11H,8,14H2,1-3H3 |
| InChIKey | TZHZFZMMGJNLLO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |