C14H23NO4S — CID 64646928
N-[[4-methoxy-3-(2-methoxyethylsulfonylmethyl)phenyl]methyl]ethanamine (PubChem CID 64646928) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is N-[[4-methoxy-3-(2-methoxyethylsulfonylmethyl)phenyl]methyl]ethanamine.
| Compound Name | N-[[4-methoxy-3-(2-methoxyethylsulfonylmethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 64646928 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[[4-methoxy-3-(2-methoxyethylsulfonylmethyl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(OC)c(CS(=O)(=O)CCOC)c1 |
| InChI | InChI=1S/C14H23NO4S/c1-4-15-10-12-5-6-14(19-3)13(9-12)11-20(16,17)8-7-18-2/h5-6,9,15H,4,7-8,10-11H2,1-3H3 |
| InChIKey | ZBBQHMILSOYTJI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|