About N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine
N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine (PubChem CID 64648028) has the molecular formula C11H19N3S2
and a molecular weight of 257.43 g/mol. Its IUPAC name is N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine |
| PubChem CID | 64648028 |
| Molecular Formula | C11H19N3S2 |
| Molecular Weight | 257.43 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine |
| SMILES | CCNC1CCC(C)CC1Sc1nncs1 |
| InChI | InChI=1S/C11H19N3S2/c1-3-12-9-5-4-8(2)6-10(9)16-11-14-13-7-15-11/h7-10,12H,3-6H2,1-2H3 |
| InChIKey | IFYDNHRTLVOWAK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine?
The IUPAC name of N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine (CID 64648028) is N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine.
What is the SMILES notation for N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine?
The canonical SMILES for N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine is CCNC1CCC(C)CC1Sc1nncs1.
What is the InChIKey of N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine?
The InChIKey is IFYDNHRTLVOWAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3S2/c1-3-12-9-5-4-8(2)6-10(9)16-11-14-13-7-15-11/h7-10,12H,3-6H2,1-2H3.
What are the key properties of N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine?
N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine has a molecular weight of 257.43 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclohexan-1-amine is sourced from PubChem (CID 64648028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).