About 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine
6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine (PubChem CID 64648507) has the molecular formula C9H17N3S2
and a molecular weight of 231.39 g/mol. Its IUPAC name is 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine.
Molecular Properties
| Compound Name | 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine |
| PubChem CID | 64648507 |
| Molecular Formula | C9H17N3S2 |
| Molecular Weight | 231.39 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine |
| SMILES | Cc1nnc(SCCCCC(C)N)s1 |
| InChI | InChI=1S/C9H17N3S2/c1-7(10)5-3-4-6-13-9-12-11-8(2)14-9/h7H,3-6,10H2,1-2H3 |
| InChIKey | VYRKGZLUWHVWDC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine?
The IUPAC name of 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine (CID 64648507) is 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine.
What is the SMILES notation for 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine?
The canonical SMILES for 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine is Cc1nnc(SCCCCC(C)N)s1.
What is the InChIKey of 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine?
The InChIKey is VYRKGZLUWHVWDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3S2/c1-7(10)5-3-4-6-13-9-12-11-8(2)14-9/h7H,3-6,10H2,1-2H3.
What are the key properties of 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine?
6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine has a molecular weight of 231.39 g/mol, XLogP of 2.46, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-2-amine is sourced from PubChem (CID 64648507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).