C18H29NS — CID 64648566
2-(3,4-dimethylphenyl)sulfanyl-N-ethylcyclooctan-1-amine (PubChem CID 64648566) has the molecular formula C18H29NS and a molecular weight of 291.50 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)sulfanyl-N-ethylcyclooctan-1-amine.
| Compound Name | 2-(3,4-dimethylphenyl)sulfanyl-N-ethylcyclooctan-1-amine |
|---|---|
| PubChem CID | 64648566 |
| Molecular Formula | C18H29NS |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 2-(3,4-dimethylphenyl)sulfanyl-N-ethylcyclooctan-1-amine |
| SMILES | CCNC1CCCCCCC1Sc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H29NS/c1-4-19-17-9-7-5-6-8-10-18(17)20-16-12-11-14(2)15(3)13-16/h11-13,17-19H,4-10H2,1-3H3 |
| InChIKey | ANNLDSCMRNLXOO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |