C13H19N5S — CID 64648593
3,3-dimethyl-1-(1-phenyltetrazol-5-yl)sulfanylbutan-2-amine (PubChem CID 64648593) has the molecular formula C13H19N5S and a molecular weight of 277.40 g/mol. Its IUPAC name is 3,3-dimethyl-1-(1-phenyltetrazol-5-yl)sulfanylbutan-2-amine.
| Compound Name | 3,3-dimethyl-1-(1-phenyltetrazol-5-yl)sulfanylbutan-2-amine |
|---|---|
| PubChem CID | 64648593 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 3,3-dimethyl-1-(1-phenyltetrazol-5-yl)sulfanylbutan-2-amine |
| SMILES | CC(C)(C)C(N)CSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C13H19N5S/c1-13(2,3)11(14)9-19-12-15-16-17-18(12)10-7-5-4-6-8-10/h4-8,11H,9,14H2,1-3H3 |
| InChIKey | ZVISZHXLJVWUHN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |