C16H17F2NOS — CID 64648679
1-[3-[(2,5-difluorophenyl)sulfanylmethyl]-4-methoxyphenyl]-N-methylmethanamine (PubChem CID 64648679) has the molecular formula C16H17F2NOS and a molecular weight of 309.38 g/mol. Its IUPAC name is 1-[3-[(2,5-difluorophenyl)sulfanylmethyl]-4-methoxyphenyl]-N-methylmethanamine.
| Compound Name | 1-[3-[(2,5-difluorophenyl)sulfanylmethyl]-4-methoxyphenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 64648679 |
| Molecular Formula | C16H17F2NOS |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-[3-[(2,5-difluorophenyl)sulfanylmethyl]-4-methoxyphenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(OC)c(CSc2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C16H17F2NOS/c1-19-9-11-3-6-15(20-2)12(7-11)10-21-16-8-13(17)4-5-14(16)18/h3-8,19H,9-10H2,1-2H3 |
| InChIKey | BTDDMCRHFBMVGX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|