C17H23N3S — CID 64649430
1-phenyl-N-propyl-2-pyrimidin-2-ylsulfanylbutan-1-amine (PubChem CID 64649430) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is 1-phenyl-N-propyl-2-pyrimidin-2-ylsulfanylbutan-1-amine.
| Compound Name | 1-phenyl-N-propyl-2-pyrimidin-2-ylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 64649430 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 1-phenyl-N-propyl-2-pyrimidin-2-ylsulfanylbutan-1-amine |
| SMILES | CCCNC(c1ccccc1)C(CC)Sc1ncccn1 |
| InChI | InChI=1S/C17H23N3S/c1-3-11-18-16(14-9-6-5-7-10-14)15(4-2)21-17-19-12-8-13-20-17/h5-10,12-13,15-16,18H,3-4,11H2,1-2H3 |
| InChIKey | ZFJKPIZTXGZKFS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |