About 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine
6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine (PubChem CID 64650120) has the molecular formula C12H24N4S
and a molecular weight of 256.42 g/mol. Its IUPAC name is 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine.
Molecular Properties
| Compound Name | 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine |
| PubChem CID | 64650120 |
| Molecular Formula | C12H24N4S |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine |
| SMILES | CCCNC(C)CCCCSc1nncn1C |
| InChI | InChI=1S/C12H24N4S/c1-4-8-13-11(2)7-5-6-9-17-12-15-14-10-16(12)3/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | CMUZUNBIBIRZCR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine?
The IUPAC name of 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine (CID 64650120) is 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine.
What is the SMILES notation for 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine?
The canonical SMILES for 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine is CCCNC(C)CCCCSc1nncn1C.
What is the InChIKey of 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine?
The InChIKey is CMUZUNBIBIRZCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4S/c1-4-8-13-11(2)7-5-6-9-17-12-15-14-10-16(12)3/h10-11,13H,4-9H2,1-3H3.
What are the key properties of 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine?
6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine has a molecular weight of 256.42 g/mol, XLogP of 2.47, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-propylhexan-2-amine is sourced from PubChem (CID 64650120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).