About N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine
N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine (PubChem CID 64650633) has the molecular formula C10H17N3OS2
and a molecular weight of 259.40 g/mol. Its IUPAC name is N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine.
Molecular Properties
| Compound Name | N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine |
| PubChem CID | 64650633 |
| Molecular Formula | C10H17N3OS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine |
| SMILES | CCNC1CCOCC1Sc1nnc(C)s1 |
| InChI | InChI=1S/C10H17N3OS2/c1-3-11-8-4-5-14-6-9(8)16-10-13-12-7(2)15-10/h8-9,11H,3-6H2,1-2H3 |
| InChIKey | LGTQZPGNZTZQSQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine?
The IUPAC name of N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine (CID 64650633) is N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine.
What is the SMILES notation for N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine?
The canonical SMILES for N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine is CCNC1CCOCC1Sc1nnc(C)s1.
What is the InChIKey of N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine?
The InChIKey is LGTQZPGNZTZQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3OS2/c1-3-11-8-4-5-14-6-9(8)16-10-13-12-7(2)15-10/h8-9,11H,3-6H2,1-2H3.
What are the key properties of N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine?
N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine has a molecular weight of 259.40 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]oxan-4-amine is sourced from PubChem (CID 64650633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).