C14H23NS — CID 64650723
2-(3,4-dimethylphenyl)sulfanyl-N-methylpentan-3-amine (PubChem CID 64650723) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)sulfanyl-N-methylpentan-3-amine.
| Compound Name | 2-(3,4-dimethylphenyl)sulfanyl-N-methylpentan-3-amine |
|---|---|
| PubChem CID | 64650723 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-(3,4-dimethylphenyl)sulfanyl-N-methylpentan-3-amine |
| SMILES | CCC(NC)C(C)Sc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H23NS/c1-6-14(15-5)12(4)16-13-8-7-10(2)11(3)9-13/h7-9,12,14-15H,6H2,1-5H3 |
| InChIKey | CVSGEELZKUPKEQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |