C12H7F2N3O3S — CID 6465235
N-(2,5-difluorophenyl)-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 6465235) has the molecular formula C12H7F2N3O3S and a molecular weight of 311.27 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-(2,5-difluorophenyl)-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 6465235 |
| Molecular Formula | C12H7F2N3O3S |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | N-(2,5-difluorophenyl)-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)ccc1F)c1cccc2nonc12 |
| InChI | InChI=1S/C12H7F2N3O3S/c13-7-4-5-8(14)10(6-7)17-21(18,19)11-3-1-2-9-12(11)16-20-15-9/h1-6,17H |
| InChIKey | SKLMLYILNLHCKQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|