C17H29NO2S — CID 64653695
1-[3-(butylsulfinylmethyl)-4-ethoxyphenyl]-N-ethylethanamine (PubChem CID 64653695) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is 1-[3-(butylsulfinylmethyl)-4-ethoxyphenyl]-N-ethylethanamine.
| Compound Name | 1-[3-(butylsulfinylmethyl)-4-ethoxyphenyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 64653695 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-[3-(butylsulfinylmethyl)-4-ethoxyphenyl]-N-ethylethanamine |
| SMILES | CCCCS(=O)Cc1cc(C(C)NCC)ccc1OCC |
| InChI | InChI=1S/C17H29NO2S/c1-5-8-11-21(19)13-16-12-15(14(4)18-6-2)9-10-17(16)20-7-3/h9-10,12,14,18H,5-8,11,13H2,1-4H3 |
| InChIKey | JSCZGLVUAQIUSP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |