About 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one
5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one (PubChem CID 64654307) has the molecular formula C15H19ClN2OS
and a molecular weight of 310.85 g/mol. Its IUPAC name is 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one |
| PubChem CID | 64654307 |
| Molecular Formula | C15H19ClN2OS |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one |
| SMILES | CN1CC(NC2CCSc3ccc(Cl)cc32)CCC1=O |
| InChI | InChI=1S/C15H19ClN2OS/c1-18-9-11(3-5-15(18)19)17-13-6-7-20-14-4-2-10(16)8-12(13)14/h2,4,8,11,13,17H,3,5-7,9H2,1H3 |
| InChIKey | JSTFHLMYMDGKAS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one?
The IUPAC name of 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one (CID 64654307) is 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one.
What is the SMILES notation for 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one?
The canonical SMILES for 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one is CN1CC(NC2CCSc3ccc(Cl)cc32)CCC1=O.
What is the InChIKey of 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one?
The InChIKey is JSTFHLMYMDGKAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClN2OS/c1-18-9-11(3-5-15(18)19)17-13-6-7-20-14-4-2-10(16)8-12(13)14/h2,4,8,11,13,17H,3,5-7,9H2,1H3.
What are the key properties of 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one?
5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one has a molecular weight of 310.85 g/mol, XLogP of 3.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]-1-methylpiperidin-2-one is sourced from PubChem (CID 64654307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).