About 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine
1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine (PubChem CID 64656247) has the molecular formula C12H25NOS
and a molecular weight of 231.40 g/mol. Its IUPAC name is 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine.
Molecular Properties
| Compound Name | 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine |
| PubChem CID | 64656247 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine |
| SMILES | CNC(CS(=O)C1CCCC1)C(C)(C)C |
| InChI | InChI=1S/C12H25NOS/c1-12(2,3)11(13-4)9-15(14)10-7-5-6-8-10/h10-11,13H,5-9H2,1-4H3 |
| InChIKey | ONVDKYUULMZPPU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine?
The IUPAC name of 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine (CID 64656247) is 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine.
What is the SMILES notation for 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine?
The canonical SMILES for 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine is CNC(CS(=O)C1CCCC1)C(C)(C)C.
What is the InChIKey of 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine?
The InChIKey is ONVDKYUULMZPPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NOS/c1-12(2,3)11(13-4)9-15(14)10-7-5-6-8-10/h10-11,13H,5-9H2,1-4H3.
What are the key properties of 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine?
1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine has a molecular weight of 231.40 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylsulfinyl-N,3,3-trimethylbutan-2-amine is sourced from PubChem (CID 64656247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).