C19H30N2O3 — CID 6465662
3-(4-cyclohexylpiperazine-1-carbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 6465662) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-(4-cyclohexylpiperazine-1-carbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 3-(4-cyclohexylpiperazine-1-carbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 6465662 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 3-(4-cyclohexylpiperazine-1-carbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(O)C1C2CCC(C2)C1C(=O)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H30N2O3/c22-18(16-13-6-7-14(12-13)17(16)19(23)24)21-10-8-20(9-11-21)15-4-2-1-3-5-15/h13-17H,1-12H2,(H,23,24) |
| InChIKey | KRHNZEPQXTXLJB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |