C17H24N2O4S — CID 6465710
4-[[3-(cyclopentylcarbamoyl)-4-ethyl-5-methylthiophen-2-yl]amino]-4-oxobutanoic acid (PubChem CID 6465710) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-[[3-(cyclopentylcarbamoyl)-4-ethyl-5-methylthiophen-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-(cyclopentylcarbamoyl)-4-ethyl-5-methylthiophen-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6465710 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-[[3-(cyclopentylcarbamoyl)-4-ethyl-5-methylthiophen-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCc1c(C)sc(NC(=O)CCC(=O)O)c1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H24N2O4S/c1-3-12-10(2)24-17(19-13(20)8-9-14(21)22)15(12)16(23)18-11-6-4-5-7-11/h11H,3-9H2,1-2H3,(H,18,23)(H,19,20)(H,21,22) |
| InChIKey | XXZUYXXPFKWMSQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |