About 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one
3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one (PubChem CID 646576) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one.
Molecular Properties
| Compound Name | 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one |
| PubChem CID | 646576 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one |
| SMILES | CCc1n[nH]c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C11H16N2O/c1-4-7-10-8(13-12-7)5-11(2,3)6-9(10)14/h4-6H2,1-3H3,(H,12,13) |
| InChIKey | XANZTOAQZAOTIH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one?
The IUPAC name of 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one (CID 646576) is 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one.
What is the SMILES notation for 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one?
The canonical SMILES for 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one is CCc1n[nH]c2c1C(=O)CC(C)(C)C2.
What is the InChIKey of 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one?
The InChIKey is XANZTOAQZAOTIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O/c1-4-7-10-8(13-12-7)5-11(2,3)6-9(10)14/h4-6H2,1-3H3,(H,12,13).
What are the key properties of 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one?
3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one has a molecular weight of 192.26 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one is sourced from PubChem (CID 646576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).